C15H9FN2O — CID 141293176
N-(2-fluoro-3-pyridinyl)tricyclo[4.3.0.02,4]nona-1,4,6,8-tetraene-7-carboxamide (PubChem CID 141293176) has the molecular formula C15H9FN2O and a molecular weight of 252.25 g/mol. Its IUPAC name is N-(2-fluoro-3-pyridinyl)tricyclo[4.3.0.02,4]nona-1,4,6,8-tetraene-7-carboxamide.
| Compound Name | N-(2-fluoro-3-pyridinyl)tricyclo[4.3.0.02,4]nona-1,4,6,8-tetraene-7-carboxamide |
|---|---|
| PubChem CID | 141293176 |
| Molecular Formula | C15H9FN2O |
| Molecular Weight | 252.25 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | N-(2-fluoro-3-pyridinyl)tricyclo[4.3.0.02,4]nona-1,4,6,8-tetraene-7-carboxamide |
| SMILES | O=C(Nc1cccnc1F)C1=C2C=C3CC3=C2C=C1 |
| InChI | InChI=1S/C15H9FN2O/c16-14-13(2-1-5-17-14)18-15(19)10-4-3-9-11-6-8(11)7-12(9)10/h1-5,7H,6H2,(H,18,19) |
| InChIKey | QCWLXDDJCCOVMX-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.25 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|