C22H20F4Si — CID 141294986
2-[4-[2-(2,6-difluoro-4-propylphenyl)ethynyl]-2,6-difluorophenyl]ethynyl-trimethylsilane (PubChem CID 141294986) has the molecular formula C22H20F4Si and a molecular weight of 388.48 g/mol. Its IUPAC name is 2-[4-[2-(2,6-difluoro-4-propylphenyl)ethynyl]-2,6-difluorophenyl]ethynyl-trimethylsilane.
| Compound Name | 2-[4-[2-(2,6-difluoro-4-propylphenyl)ethynyl]-2,6-difluorophenyl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 141294986 |
| Molecular Formula | C22H20F4Si |
| Molecular Weight | 388.48 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | 2-[4-[2-(2,6-difluoro-4-propylphenyl)ethynyl]-2,6-difluorophenyl]ethynyl-trimethylsilane |
| SMILES | CCCc1cc(F)c(C#Cc2cc(F)c(C#C[Si](C)(C)C)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C22H20F4Si/c1-5-6-15-11-19(23)17(20(24)12-15)8-7-16-13-21(25)18(22(26)14-16)9-10-27(2,3)4/h11-14H,5-6H2,1-4H3 |
| InChIKey | GEWYPEHLRMOSIE-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.48 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|