C30H28F3N7O3S — CID 141296897
N-[(E)-(4,5-difluoro-2-hydroxyphenyl)methylideneamino]-2-[4-[[2-[4-[(3-fluorophenyl)carbamoylamino]phenyl]-1,3-thiazol-4-yl]methyl]piperazin-1-yl]acetamide (PubChem CID 141296897) has the molecular formula C30H28F3N7O3S and a molecular weight of 623.66 g/mol. Its IUPAC name is N-[(E)-(4,5-difluoro-2-hydroxyphenyl)methylideneamino]-2-[4-[[2-[4-[(3-fluorophenyl)carbamoylamino]phenyl]-1,3-thiazol-4-yl]methyl]piperazin-1-yl]acetamide.
| Compound Name | N-[(E)-(4,5-difluoro-2-hydroxyphenyl)methylideneamino]-2-[4-[[2-[4-[(3-fluorophenyl)carbamoylamino]phenyl]-1,3-thiazol-4-yl]methyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 141296897 |
| Molecular Formula | C30H28F3N7O3S |
| Molecular Weight | 623.66 g/mol |
| Exact Mass | 623.19 |
| IUPAC Name | N-[(E)-(4,5-difluoro-2-hydroxyphenyl)methylideneamino]-2-[4-[[2-[4-[(3-fluorophenyl)carbamoylamino]phenyl]-1,3-thiazol-4-yl]methyl]piperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(Cc2csc(-c3ccc(NC(=O)Nc4cccc(F)c4)cc3)n2)CC1)N/N=C/c1cc(F)c(F)cc1O |
| InChI | InChI=1S/C30H28F3N7O3S/c31-21-2-1-3-23(13-21)37-30(43)36-22-6-4-19(5-7-22)29-35-24(18-44-29)16-39-8-10-40(11-9-39)17-28(42)38-34-15-20-12-25(32)26(33)14-27(20)41/h1-7,12-15,18,41H,8-11,16-17H2,(H,38,42)(H2,36,37,43)/b34-15+ |
| InChIKey | SXKOYHZYHYBYRJ-PUHLOBNQSA-N |
| XLogP | 4.84 |
| TPSA | 122.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.66 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|