C23H27N7O2S — CID 66554017
1-[4-[4-[[4-(2-hydrazinyl-2-oxoethyl)piperazin-1-yl]methyl]-1,3-thiazol-2-yl]phenyl]-3-phenylurea (PubChem CID 66554017) has the molecular formula C23H27N7O2S and a molecular weight of 465.58 g/mol. Its IUPAC name is 1-[4-[4-[[4-(2-hydrazinyl-2-oxoethyl)piperazin-1-yl]methyl]-1,3-thiazol-2-yl]phenyl]-3-phenylurea.
| Compound Name | 1-[4-[4-[[4-(2-hydrazinyl-2-oxoethyl)piperazin-1-yl]methyl]-1,3-thiazol-2-yl]phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 66554017 |
| Molecular Formula | C23H27N7O2S |
| Molecular Weight | 465.58 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | 1-[4-[4-[[4-(2-hydrazinyl-2-oxoethyl)piperazin-1-yl]methyl]-1,3-thiazol-2-yl]phenyl]-3-phenylurea |
| SMILES | NNC(=O)CN1CCN(Cc2csc(-c3ccc(NC(=O)Nc4ccccc4)cc3)n2)CC1 |
| InChI | InChI=1S/C23H27N7O2S/c24-28-21(31)15-30-12-10-29(11-13-30)14-20-16-33-22(25-20)17-6-8-19(9-7-17)27-23(32)26-18-4-2-1-3-5-18/h1-9,16H,10-15,24H2,(H,28,31)(H2,26,27,32) |
| InChIKey | ADKJDMYVODHCAA-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 115.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.58 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|