C40H76ClNO3 — CID 141296972
2-hydroxyethyl-[(Z)-2-[(Z)-octadec-9-enoyl]-3-oxoicos-11-enyl]azanium chloride (PubChem CID 141296972) has the molecular formula C40H76ClNO3 and a molecular weight of 654.51 g/mol. Its IUPAC name is 2-hydroxyethyl-[(Z)-2-[(Z)-octadec-9-enoyl]-3-oxoicos-11-enyl]azanium chloride.
| Compound Name | 2-hydroxyethyl-[(Z)-2-[(Z)-octadec-9-enoyl]-3-oxoicos-11-enyl]azanium chloride |
|---|---|
| PubChem CID | 141296972 |
| Molecular Formula | C40H76ClNO3 |
| Molecular Weight | 654.51 g/mol |
| Exact Mass | 653.55 |
| IUPAC Name | 2-hydroxyethyl-[(Z)-2-[(Z)-octadec-9-enoyl]-3-oxoicos-11-enyl]azanium chloride |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)C(C[NH2+]CCO)C(=O)CCCCCCC/C=C\CCCCCCCC.[Cl-] |
| InChI | InChI=1S/C40H75NO3.ClH/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-39(43)38(37-41-35-36-42)40(44)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2;/h17-20,38,41-42H,3-16,21-37H2,1-2H3;1H/b19-17-,20-18-; |
| InChIKey | BEOVMWONLLVJQN-AWLASTDMSA-N |
| XLogP | 7.38 |
| TPSA | 70.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.51 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|