C15H16FN3O2 — CID 141297442
1-[2-[(cyclopropylamino)methyl]-6-fluorophenyl]-3-methylpyrazole-4-carboxylic acid (PubChem CID 141297442) has the molecular formula C15H16FN3O2 and a molecular weight of 289.31 g/mol. Its IUPAC name is 1-[2-[(cyclopropylamino)methyl]-6-fluorophenyl]-3-methylpyrazole-4-carboxylic acid.
| Compound Name | 1-[2-[(cyclopropylamino)methyl]-6-fluorophenyl]-3-methylpyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 141297442 |
| Molecular Formula | C15H16FN3O2 |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 1-[2-[(cyclopropylamino)methyl]-6-fluorophenyl]-3-methylpyrazole-4-carboxylic acid |
| SMILES | Cc1nn(-c2c(F)cccc2CNC2CC2)cc1C(=O)O |
| InChI | InChI=1S/C15H16FN3O2/c1-9-12(15(20)21)8-19(18-9)14-10(3-2-4-13(14)16)7-17-11-5-6-11/h2-4,8,11,17H,5-7H2,1H3,(H,20,21) |
| InChIKey | OAIAAHWQBOYRPM-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |