C14H16FN3O3 — CID 141297452
[3-fluoro-2-[4-(hydroxymethyl)-3-methylpyrazol-1-yl]phenyl]methyl-methylcarbamic acid (PubChem CID 141297452) has the molecular formula C14H16FN3O3 and a molecular weight of 293.30 g/mol. Its IUPAC name is [3-fluoro-2-[4-(hydroxymethyl)-3-methylpyrazol-1-yl]phenyl]methyl-methylcarbamic acid.
| Compound Name | [3-fluoro-2-[4-(hydroxymethyl)-3-methylpyrazol-1-yl]phenyl]methyl-methylcarbamic acid |
|---|---|
| PubChem CID | 141297452 |
| Molecular Formula | C14H16FN3O3 |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | [3-fluoro-2-[4-(hydroxymethyl)-3-methylpyrazol-1-yl]phenyl]methyl-methylcarbamic acid |
| SMILES | Cc1nn(-c2c(F)cccc2CN(C)C(=O)O)cc1CO |
| InChI | InChI=1S/C14H16FN3O3/c1-9-11(8-19)7-18(16-9)13-10(4-3-5-12(13)15)6-17(2)14(20)21/h3-5,7,19H,6,8H2,1-2H3,(H,20,21) |
| InChIKey | LQLABALOCOSYBC-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |