C24H28FN5O — CID 25326473
N-[4-[4-[(1,3-dimethylpyrazol-4-yl)methylamino]piperidin-1-yl]phenyl]-2-fluorobenzamide (PubChem CID 25326473) has the molecular formula C24H28FN5O and a molecular weight of 421.52 g/mol. Its IUPAC name is N-[4-[4-[(1,3-dimethylpyrazol-4-yl)methylamino]piperidin-1-yl]phenyl]-2-fluorobenzamide.
| Compound Name | N-[4-[4-[(1,3-dimethylpyrazol-4-yl)methylamino]piperidin-1-yl]phenyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 25326473 |
| Molecular Formula | C24H28FN5O |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | N-[4-[4-[(1,3-dimethylpyrazol-4-yl)methylamino]piperidin-1-yl]phenyl]-2-fluorobenzamide |
| SMILES | Cc1nn(C)cc1CNC1CCN(c2ccc(NC(=O)c3ccccc3F)cc2)CC1 |
| InChI | InChI=1S/C24H28FN5O/c1-17-18(16-29(2)28-17)15-26-19-11-13-30(14-12-19)21-9-7-20(8-10-21)27-24(31)22-5-3-4-6-23(22)25/h3-10,16,19,26H,11-15H2,1-2H3,(H,27,31) |
| InChIKey | ZEYKYTPNBSUXAS-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|