C27H28FN3O — CID 42451084
2-fluoro-N-[4-[4-[(1-phenylcyclopropyl)amino]piperidin-1-yl]phenyl]benzamide (PubChem CID 42451084) has the molecular formula C27H28FN3O and a molecular weight of 429.54 g/mol. Its IUPAC name is 2-fluoro-N-[4-[4-[(1-phenylcyclopropyl)amino]piperidin-1-yl]phenyl]benzamide.
| Compound Name | 2-fluoro-N-[4-[4-[(1-phenylcyclopropyl)amino]piperidin-1-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 42451084 |
| Molecular Formula | C27H28FN3O |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | 2-fluoro-N-[4-[4-[(1-phenylcyclopropyl)amino]piperidin-1-yl]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(N2CCC(NC3(c4ccccc4)CC3)CC2)cc1)c1ccccc1F |
| InChI | InChI=1S/C27H28FN3O/c28-25-9-5-4-8-24(25)26(32)29-21-10-12-23(13-11-21)31-18-14-22(15-19-31)30-27(16-17-27)20-6-2-1-3-7-20/h1-13,22,30H,14-19H2,(H,29,32) |
| InChIKey | INJIFHPEECJUBT-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|