C27H27FN6O — CID 42473065
2-fluoro-N-[4-[4-[(2-phenyltriazol-4-yl)methylamino]piperidin-1-yl]phenyl]benzamide (PubChem CID 42473065) has the molecular formula C27H27FN6O and a molecular weight of 470.55 g/mol. Its IUPAC name is 2-fluoro-N-[4-[4-[(2-phenyltriazol-4-yl)methylamino]piperidin-1-yl]phenyl]benzamide.
| Compound Name | 2-fluoro-N-[4-[4-[(2-phenyltriazol-4-yl)methylamino]piperidin-1-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 42473065 |
| Molecular Formula | C27H27FN6O |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | 2-fluoro-N-[4-[4-[(2-phenyltriazol-4-yl)methylamino]piperidin-1-yl]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(N2CCC(NCc3cnn(-c4ccccc4)n3)CC2)cc1)c1ccccc1F |
| InChI | InChI=1S/C27H27FN6O/c28-26-9-5-4-8-25(26)27(35)31-21-10-12-23(13-11-21)33-16-14-20(15-17-33)29-18-22-19-30-34(32-22)24-6-2-1-3-7-24/h1-13,19-20,29H,14-18H2,(H,31,35) |
| InChIKey | GAUYNXRADDFOQH-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|