C22H24F4 — CID 141298353
3-fluoro-2-phenyl-1-(1-propylcyclohexyl)-4-(trifluoromethyl)benzene (PubChem CID 141298353) has the molecular formula C22H24F4 and a molecular weight of 364.43 g/mol. Its IUPAC name is 3-fluoro-2-phenyl-1-(1-propylcyclohexyl)-4-(trifluoromethyl)benzene.
| Compound Name | 3-fluoro-2-phenyl-1-(1-propylcyclohexyl)-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 141298353 |
| Molecular Formula | C22H24F4 |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 3-fluoro-2-phenyl-1-(1-propylcyclohexyl)-4-(trifluoromethyl)benzene |
| SMILES | CCCC1(c2ccc(C(F)(F)F)c(F)c2-c2ccccc2)CCCCC1 |
| InChI | InChI=1S/C22H24F4/c1-2-13-21(14-7-4-8-15-21)17-11-12-18(22(24,25)26)20(23)19(17)16-9-5-3-6-10-16/h3,5-6,9-12H,2,4,7-8,13-15H2,1H3 |
| InChIKey | LNPKEBOIDUBQFQ-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |