2-(1-propylcyclohexyl)benzoic acid

C16H22O2 — CID 174854619

IUPAC2-(1-propylcyclohexyl)benzoic acid
SMILESCCCC1(c2ccccc2C(=O)O)CCCCC1
InChIInChI=1S/C16H22O2/c1-2-10-16(11-6-3-7-12-16)14-9-5-4-8-13(14)15(17)18/h4-5,8-9H,2-3,6-7,10-12H2,1H3,(H,17,18)
InChIKeyWSVDWBYXSDUUKK-UHFFFAOYSA-N
MW246.35 g/mol
LogP4.39
Rot. Bonds4

About 2-(1-propylcyclohexyl)benzoic acid

2-(1-propylcyclohexyl)benzoic acid (PubChem CID 174854619) has the molecular formula C16H22O2 and a molecular weight of 246.35 g/mol. Its IUPAC name is 2-(1-propylcyclohexyl)benzoic acid.

Molecular Properties

Compound Name2-(1-propylcyclohexyl)benzoic acid
PubChem CID174854619
Molecular FormulaC16H22O2
Molecular Weight246.35 g/mol
Exact Mass246.16
IUPAC Name2-(1-propylcyclohexyl)benzoic acid
SMILESCCCC1(c2ccccc2C(=O)O)CCCCC1
InChIInChI=1S/C16H22O2/c1-2-10-16(11-6-3-7-12-16)14-9-5-4-8-13(14)15(17)18/h4-5,8-9H,2-3,6-7,10-12H2,1H3,(H,17,18)
InChIKeyWSVDWBYXSDUUKK-UHFFFAOYSA-N
XLogP4.39
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500246.35
LogP ≤ 54.39
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 2-(1-propylcyclohexyl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1-propylcyclohexyl)benzoic acid?
The IUPAC name of 2-(1-propylcyclohexyl)benzoic acid (CID 174854619) is 2-(1-propylcyclohexyl)benzoic acid.
What is the SMILES notation for 2-(1-propylcyclohexyl)benzoic acid?
The canonical SMILES for 2-(1-propylcyclohexyl)benzoic acid is CCCC1(c2ccccc2C(=O)O)CCCCC1.
What is the InChIKey of 2-(1-propylcyclohexyl)benzoic acid?
The InChIKey is WSVDWBYXSDUUKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22O2/c1-2-10-16(11-6-3-7-12-16)14-9-5-4-8-13(14)15(17)18/h4-5,8-9H,2-3,6-7,10-12H2,1H3,(H,17,18).
What are the key properties of 2-(1-propylcyclohexyl)benzoic acid?
2-(1-propylcyclohexyl)benzoic acid has a molecular weight of 246.35 g/mol, XLogP of 4.39, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-propylcyclohexyl)benzoic acid is sourced from PubChem (CID 174854619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).