C26H30F4N2O — CID 141298425
1-[4-(azetidin-1-ylmethyl)-3-fluorophenyl]-N-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]ethanimine (PubChem CID 141298425) has the molecular formula C26H30F4N2O and a molecular weight of 462.53 g/mol. Its IUPAC name is 1-[4-(azetidin-1-ylmethyl)-3-fluorophenyl]-N-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]ethanimine.
| Compound Name | 1-[4-(azetidin-1-ylmethyl)-3-fluorophenyl]-N-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]ethanimine |
|---|---|
| PubChem CID | 141298425 |
| Molecular Formula | C26H30F4N2O |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | 1-[4-(azetidin-1-ylmethyl)-3-fluorophenyl]-N-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]ethanimine |
| SMILES | CC(=NOCc1ccc(C2CCCCC2)c(C(F)(F)F)c1)c1ccc(CN2CCC2)c(F)c1 |
| InChI | InChI=1S/C26H30F4N2O/c1-18(21-9-10-22(25(27)15-21)16-32-12-5-13-32)31-33-17-19-8-11-23(20-6-3-2-4-7-20)24(14-19)26(28,29)30/h8-11,14-15,20H,2-7,12-13,16-17H2,1H3 |
| InChIKey | KEVCBSQKMVTHCI-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|