About 5-(2,2-dichloroethyl)-1H-pyrazole
5-(2,2-dichloroethyl)-1H-pyrazole (PubChem CID 141300180) has the molecular formula C5H6Cl2N2
and a molecular weight of 165.02 g/mol. Its IUPAC name is 5-(2,2-dichloroethyl)-1H-pyrazole.
Molecular Properties
| Compound Name | 5-(2,2-dichloroethyl)-1H-pyrazole |
| PubChem CID | 141300180 |
| Molecular Formula | C5H6Cl2N2 |
| Molecular Weight | 165.02 g/mol |
| Exact Mass | 163.99 |
| IUPAC Name | 5-(2,2-dichloroethyl)-1H-pyrazole |
| SMILES | ClC(Cl)Cc1ccn[nH]1 |
| InChI | InChI=1S/C5H6Cl2N2/c6-5(7)3-4-1-2-8-9-4/h1-2,5H,3H2,(H,8,9) |
| InChIKey | XKWMDXVZLKRXSI-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.02 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(2,2-dichloroethyl)-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,2-dichloroethyl)-1H-pyrazole?
The IUPAC name of 5-(2,2-dichloroethyl)-1H-pyrazole (CID 141300180) is 5-(2,2-dichloroethyl)-1H-pyrazole.
What is the SMILES notation for 5-(2,2-dichloroethyl)-1H-pyrazole?
The canonical SMILES for 5-(2,2-dichloroethyl)-1H-pyrazole is ClC(Cl)Cc1ccn[nH]1.
What is the InChIKey of 5-(2,2-dichloroethyl)-1H-pyrazole?
The InChIKey is XKWMDXVZLKRXSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6Cl2N2/c6-5(7)3-4-1-2-8-9-4/h1-2,5H,3H2,(H,8,9).
What are the key properties of 5-(2,2-dichloroethyl)-1H-pyrazole?
5-(2,2-dichloroethyl)-1H-pyrazole has a molecular weight of 165.02 g/mol, XLogP of 1.76, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,2-dichloroethyl)-1H-pyrazole is sourced from PubChem (CID 141300180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).