C5H8N2 — CID 175719546
5-(2,2,2-trideuterioethyl)-1H-pyrazole (PubChem CID 175719546) has the molecular formula C5H8N2 and a molecular weight of 99.15 g/mol. Its IUPAC name is 5-(2,2,2-trideuterioethyl)-1H-pyrazole.
| Compound Name | 5-(2,2,2-trideuterioethyl)-1H-pyrazole |
|---|---|
| PubChem CID | 175719546 |
| Molecular Formula | C5H8N2 |
| Molecular Weight | 99.15 g/mol |
| Exact Mass | 99.09 |
| IUPAC Name | 5-(2,2,2-trideuterioethyl)-1H-pyrazole |
| SMILES | [2H]C([2H])([2H])Cc1ccn[nH]1 |
| InChI | InChI=1S/C5H8N2/c1-2-5-3-4-6-7-5/h3-4H,2H2,1H3,(H,6,7)/i1D3 |
| InChIKey | CBNLNXLAIMQSTR-FIBGUPNXSA-N |
| XLogP | 0.97 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 99.15 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |