C21H21N5O2 — CID 141300393
[4-(5-amino-2-pyridin-3-ylpyrimidin-4-yl)oxyphenyl]-piperidin-1-ylmethanone (PubChem CID 141300393) has the molecular formula C21H21N5O2 and a molecular weight of 375.43 g/mol. Its IUPAC name is [4-(5-amino-2-pyridin-3-ylpyrimidin-4-yl)oxyphenyl]-piperidin-1-ylmethanone.
| Compound Name | [4-(5-amino-2-pyridin-3-ylpyrimidin-4-yl)oxyphenyl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 141300393 |
| Molecular Formula | C21H21N5O2 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | [4-(5-amino-2-pyridin-3-ylpyrimidin-4-yl)oxyphenyl]-piperidin-1-ylmethanone |
| SMILES | Nc1cnc(-c2cccnc2)nc1Oc1ccc(C(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C21H21N5O2/c22-18-14-24-19(16-5-4-10-23-13-16)25-20(18)28-17-8-6-15(7-9-17)21(27)26-11-2-1-3-12-26/h4-10,13-14H,1-3,11-12,22H2 |
| InChIKey | DGHLVELWOMYRJO-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 94.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |