C21H18ClN3O2 — CID 42670092
[4-(3-chlorophenoxy)-2-phenylpyrimidin-5-yl]-pyrrolidin-1-ylmethanone (PubChem CID 42670092) has the molecular formula C21H18ClN3O2 and a molecular weight of 379.85 g/mol. Its IUPAC name is [4-(3-chlorophenoxy)-2-phenylpyrimidin-5-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [4-(3-chlorophenoxy)-2-phenylpyrimidin-5-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 42670092 |
| Molecular Formula | C21H18ClN3O2 |
| Molecular Weight | 379.85 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | [4-(3-chlorophenoxy)-2-phenylpyrimidin-5-yl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C(c1cnc(-c2ccccc2)nc1Oc1cccc(Cl)c1)N1CCCC1 |
| InChI | InChI=1S/C21H18ClN3O2/c22-16-9-6-10-17(13-16)27-20-18(21(26)25-11-4-5-12-25)14-23-19(24-20)15-7-2-1-3-8-15/h1-3,6-10,13-14H,4-5,11-12H2 |
| InChIKey | MJRKMJCAEYCZDH-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.85 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |