C26H27N3O4 — CID 42670111
ethyl 1-[4-(4-methylphenoxy)-2-phenylpyrimidine-5-carbonyl]piperidine-3-carboxylate (PubChem CID 42670111) has the molecular formula C26H27N3O4 and a molecular weight of 445.52 g/mol. Its IUPAC name is ethyl 1-[4-(4-methylphenoxy)-2-phenylpyrimidine-5-carbonyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[4-(4-methylphenoxy)-2-phenylpyrimidine-5-carbonyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 42670111 |
| Molecular Formula | C26H27N3O4 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | ethyl 1-[4-(4-methylphenoxy)-2-phenylpyrimidine-5-carbonyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)c2cnc(-c3ccccc3)nc2Oc2ccc(C)cc2)C1 |
| InChI | InChI=1S/C26H27N3O4/c1-3-32-26(31)20-10-7-15-29(17-20)25(30)22-16-27-23(19-8-5-4-6-9-19)28-24(22)33-21-13-11-18(2)12-14-21/h4-6,8-9,11-14,16,20H,3,7,10,15,17H2,1-2H3 |
| InChIKey | UPVJYKAZNDJSCZ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 81.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |