C26H27N3O5 — CID 93138214
ethyl (3S)-1-[2-(4-methoxyphenyl)-4-phenoxypyrimidine-5-carbonyl]piperidine-3-carboxylate (PubChem CID 93138214) has the molecular formula C26H27N3O5 and a molecular weight of 461.52 g/mol. Its IUPAC name is ethyl (3S)-1-[2-(4-methoxyphenyl)-4-phenoxypyrimidine-5-carbonyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3S)-1-[2-(4-methoxyphenyl)-4-phenoxypyrimidine-5-carbonyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 93138214 |
| Molecular Formula | C26H27N3O5 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | ethyl (3S)-1-[2-(4-methoxyphenyl)-4-phenoxypyrimidine-5-carbonyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCCN(C(=O)c2cnc(-c3ccc(OC)cc3)nc2Oc2ccccc2)C1 |
| InChI | InChI=1S/C26H27N3O5/c1-3-33-26(31)19-8-7-15-29(17-19)25(30)22-16-27-23(18-11-13-20(32-2)14-12-18)28-24(22)34-21-9-5-4-6-10-21/h4-6,9-14,16,19H,3,7-8,15,17H2,1-2H3/t19-/m0/s1 |
| InChIKey | DIVUKHIVSQNVHM-IBGZPJMESA-N |
| XLogP | 4.36 |
| TPSA | 90.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |