(2,5-dihydroxyimidazolidin-4-yl)phosphonic acid

C3H9N2O5P — CID 141302500

IUPAC(2,5-dihydroxyimidazolidin-4-yl)phosphonic acid
SMILESO=P(O)(O)C1NC(O)NC1O
InChIInChI=1S/C3H9N2O5P/c6-1-2(11(8,9)10)5-3(7)4-1/h1-7H,(H2,8,9,10)
InChIKeyOVRJYOZFCCJLDO-UHFFFAOYSA-N
MW184.09 g/mol
LogP-2.72
Rot. Bonds1

About (2,5-dihydroxyimidazolidin-4-yl)phosphonic acid

(2,5-dihydroxyimidazolidin-4-yl)phosphonic acid (PubChem CID 141302500) has the molecular formula C3H9N2O5P and a molecular weight of 184.09 g/mol. Its IUPAC name is (2,5-dihydroxyimidazolidin-4-yl)phosphonic acid.

Molecular Properties

Compound Name(2,5-dihydroxyimidazolidin-4-yl)phosphonic acid
PubChem CID141302500
Molecular FormulaC3H9N2O5P
Molecular Weight184.09 g/mol
Exact Mass184.02
IUPAC Name(2,5-dihydroxyimidazolidin-4-yl)phosphonic acid
SMILESO=P(O)(O)C1NC(O)NC1O
InChIInChI=1S/C3H9N2O5P/c6-1-2(11(8,9)10)5-3(7)4-1/h1-7H,(H2,8,9,10)
InChIKeyOVRJYOZFCCJLDO-UHFFFAOYSA-N
XLogP-2.72
TPSA122.05 Ų
H-Bond Donors6
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500184.09
LogP ≤ 5-2.72
H-Bond Donors ≤ 56
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze (2,5-dihydroxyimidazolidin-4-yl)phosphonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

phosphoric acid;titanium
CID 139211571
phosphoric acid;titanium
CID 173034953
cyclohexane-1,2,3,4,5,6-hexol;phosphoric acid
CID 18946121
CID 173097851
CID 173097851
CID 22052907
CID 22052907
phosphoric acid;titanium;hydrate
CID 173357749
[(1R,3aR,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-1-yl]phosphonic acid;hydrobromide
CID 56849679
lithium;hydride;phosphoric acid;titanium;yttrium
CID 175004074
dioxotitanium;phosphoric acid;titanium
CID 175067167
phosphane;phosphoric acid
CID 173160232
methane;phosphoric acid
CID 18515646
phosphoric acid;octahydrate
CID 173160172

Frequently Asked Questions

What is the IUPAC name of (2,5-dihydroxyimidazolidin-4-yl)phosphonic acid?
The IUPAC name of (2,5-dihydroxyimidazolidin-4-yl)phosphonic acid (CID 141302500) is (2,5-dihydroxyimidazolidin-4-yl)phosphonic acid.
What is the SMILES notation for (2,5-dihydroxyimidazolidin-4-yl)phosphonic acid?
The canonical SMILES for (2,5-dihydroxyimidazolidin-4-yl)phosphonic acid is O=P(O)(O)C1NC(O)NC1O.
What is the InChIKey of (2,5-dihydroxyimidazolidin-4-yl)phosphonic acid?
The InChIKey is OVRJYOZFCCJLDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N2O5P/c6-1-2(11(8,9)10)5-3(7)4-1/h1-7H,(H2,8,9,10).
What are the key properties of (2,5-dihydroxyimidazolidin-4-yl)phosphonic acid?
(2,5-dihydroxyimidazolidin-4-yl)phosphonic acid has a molecular weight of 184.09 g/mol, XLogP of -2.72, 1 rotatable bonds, 6 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dihydroxyimidazolidin-4-yl)phosphonic acid is sourced from PubChem (CID 141302500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).