C21H19ClN2O3 — CID 141302639
(Z)-3-[4-[3-(3-chloro-4-propan-2-yloxyphenyl)-1H-pyrazol-5-yl]phenyl]prop-2-enoic acid (PubChem CID 141302639) has the molecular formula C21H19ClN2O3 and a molecular weight of 382.85 g/mol. Its IUPAC name is (Z)-3-[4-[3-(3-chloro-4-propan-2-yloxyphenyl)-1H-pyrazol-5-yl]phenyl]prop-2-enoic acid.
| Compound Name | (Z)-3-[4-[3-(3-chloro-4-propan-2-yloxyphenyl)-1H-pyrazol-5-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 141302639 |
| Molecular Formula | C21H19ClN2O3 |
| Molecular Weight | 382.85 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | (Z)-3-[4-[3-(3-chloro-4-propan-2-yloxyphenyl)-1H-pyrazol-5-yl]phenyl]prop-2-enoic acid |
| SMILES | CC(C)Oc1ccc(-c2cc(-c3ccc(/C=C\C(=O)O)cc3)[nH]n2)cc1Cl |
| InChI | InChI=1S/C21H19ClN2O3/c1-13(2)27-20-9-8-16(11-17(20)22)19-12-18(23-24-19)15-6-3-14(4-7-15)5-10-21(25)26/h3-13H,1-2H3,(H,23,24)(H,25,26)/b10-5- |
| InChIKey | HQXZZKIDVMUARA-YHYXMXQVSA-N |
| XLogP | 5.28 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.85 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|