C23H25ClN2O4 — CID 141302553
4-[3-[3-(3-chloro-4-propan-2-yloxyphenyl)-1H-pyrazol-5-yl]-2-methylphenoxy]butanoic acid (PubChem CID 141302553) has the molecular formula C23H25ClN2O4 and a molecular weight of 428.92 g/mol. Its IUPAC name is 4-[3-[3-(3-chloro-4-propan-2-yloxyphenyl)-1H-pyrazol-5-yl]-2-methylphenoxy]butanoic acid.
| Compound Name | 4-[3-[3-(3-chloro-4-propan-2-yloxyphenyl)-1H-pyrazol-5-yl]-2-methylphenoxy]butanoic acid |
|---|---|
| PubChem CID | 141302553 |
| Molecular Formula | C23H25ClN2O4 |
| Molecular Weight | 428.92 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | 4-[3-[3-(3-chloro-4-propan-2-yloxyphenyl)-1H-pyrazol-5-yl]-2-methylphenoxy]butanoic acid |
| SMILES | Cc1c(OCCCC(=O)O)cccc1-c1cc(-c2ccc(OC(C)C)c(Cl)c2)n[nH]1 |
| InChI | InChI=1S/C23H25ClN2O4/c1-14(2)30-22-10-9-16(12-18(22)24)19-13-20(26-25-19)17-6-4-7-21(15(17)3)29-11-5-8-23(27)28/h4,6-7,9-10,12-14H,5,8,11H2,1-3H3,(H,25,26)(H,27,28) |
| InChIKey | NACOTCSQUMYJBW-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 84.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.92 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|