C27H31ClN2O3 — CID 67399814
ethyl 4-[3-[2-(3-chloro-4-propan-2-yloxyphenyl)pyrimidin-5-yl]-2-ethylphenyl]butanoate (PubChem CID 67399814) has the molecular formula C27H31ClN2O3 and a molecular weight of 467.01 g/mol. Its IUPAC name is ethyl 4-[3-[2-(3-chloro-4-propan-2-yloxyphenyl)pyrimidin-5-yl]-2-ethylphenyl]butanoate.
| Compound Name | ethyl 4-[3-[2-(3-chloro-4-propan-2-yloxyphenyl)pyrimidin-5-yl]-2-ethylphenyl]butanoate |
|---|---|
| PubChem CID | 67399814 |
| Molecular Formula | C27H31ClN2O3 |
| Molecular Weight | 467.01 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | ethyl 4-[3-[2-(3-chloro-4-propan-2-yloxyphenyl)pyrimidin-5-yl]-2-ethylphenyl]butanoate |
| SMILES | CCOC(=O)CCCc1cccc(-c2cnc(-c3ccc(OC(C)C)c(Cl)c3)nc2)c1CC |
| InChI | InChI=1S/C27H31ClN2O3/c1-5-22-19(10-8-12-26(31)32-6-2)9-7-11-23(22)21-16-29-27(30-17-21)20-13-14-25(24(28)15-20)33-18(3)4/h7,9,11,13-18H,5-6,8,10,12H2,1-4H3 |
| InChIKey | OTVUIZWDYWALHD-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.01 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |