C16H17ClN2O2 — CID 123216821
4-[3-(2-chloropyrimidin-5-yl)-2-ethylphenyl]butanoic acid (PubChem CID 123216821) has the molecular formula C16H17ClN2O2 and a molecular weight of 304.78 g/mol. Its IUPAC name is 4-[3-(2-chloropyrimidin-5-yl)-2-ethylphenyl]butanoic acid.
| Compound Name | 4-[3-(2-chloropyrimidin-5-yl)-2-ethylphenyl]butanoic acid |
|---|---|
| PubChem CID | 123216821 |
| Molecular Formula | C16H17ClN2O2 |
| Molecular Weight | 304.78 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 4-[3-(2-chloropyrimidin-5-yl)-2-ethylphenyl]butanoic acid |
| SMILES | CCc1c(CCCC(=O)O)cccc1-c1cnc(Cl)nc1 |
| InChI | InChI=1S/C16H17ClN2O2/c1-2-13-11(6-4-8-15(20)21)5-3-7-14(13)12-9-18-16(17)19-10-12/h3,5,7,9-10H,2,4,6,8H2,1H3,(H,20,21) |
| InChIKey | ARXNHDSPGSXWAQ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.78 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |