C16H19BrN2O2S — CID 67289130
ethyl 4-[3-(3-bromo-1,2,4-thiadiazol-5-yl)-2-ethylphenyl]butanoate (PubChem CID 67289130) has the molecular formula C16H19BrN2O2S and a molecular weight of 383.31 g/mol. Its IUPAC name is ethyl 4-[3-(3-bromo-1,2,4-thiadiazol-5-yl)-2-ethylphenyl]butanoate.
| Compound Name | ethyl 4-[3-(3-bromo-1,2,4-thiadiazol-5-yl)-2-ethylphenyl]butanoate |
|---|---|
| PubChem CID | 67289130 |
| Molecular Formula | C16H19BrN2O2S |
| Molecular Weight | 383.31 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | ethyl 4-[3-(3-bromo-1,2,4-thiadiazol-5-yl)-2-ethylphenyl]butanoate |
| SMILES | CCOC(=O)CCCc1cccc(-c2nc(Br)ns2)c1CC |
| InChI | InChI=1S/C16H19BrN2O2S/c1-3-12-11(8-6-10-14(20)21-4-2)7-5-9-13(12)15-18-16(17)19-22-15/h5,7,9H,3-4,6,8,10H2,1-2H3 |
| InChIKey | NSQSFOQEKZFIMI-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.31 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |