C14H14N4 — CID 141304295
[4-(6-methylimidazo[4,5-b]pyridin-3-yl)phenyl]methanamine (PubChem CID 141304295) has the molecular formula C14H14N4 and a molecular weight of 238.29 g/mol. Its IUPAC name is [4-(6-methylimidazo[4,5-b]pyridin-3-yl)phenyl]methanamine.
| Compound Name | [4-(6-methylimidazo[4,5-b]pyridin-3-yl)phenyl]methanamine |
|---|---|
| PubChem CID | 141304295 |
| Molecular Formula | C14H14N4 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | [4-(6-methylimidazo[4,5-b]pyridin-3-yl)phenyl]methanamine |
| SMILES | Cc1cnc2c(c1)ncn2-c1ccc(CN)cc1 |
| InChI | InChI=1S/C14H14N4/c1-10-6-13-14(16-8-10)18(9-17-13)12-4-2-11(7-15)3-5-12/h2-6,8-9H,7,15H2,1H3 |
| InChIKey | JQRFUAQWGIKGTD-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |