About 3-[3-(aminomethyl)-4-ethoxyphenyl]-N-[(4-ethylphenyl)methyl]imidazo[4,5-b]pyridin-6-amine
3-[3-(aminomethyl)-4-ethoxyphenyl]-N-[(4-ethylphenyl)methyl]imidazo[4,5-b]pyridin-6-amine (PubChem CID 71521187) has the molecular formula C24H27N5O
and a molecular weight of 401.51 g/mol. Its IUPAC name is 3-[3-(aminomethyl)-4-ethoxyphenyl]-N-[(4-ethylphenyl)methyl]imidazo[4,5-b]pyridin-6-amine.
Molecular Properties
| Compound Name | 3-[3-(aminomethyl)-4-ethoxyphenyl]-N-[(4-ethylphenyl)methyl]imidazo[4,5-b]pyridin-6-amine |
| PubChem CID | 71521187 |
| Molecular Formula | C24H27N5O |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | 3-[3-(aminomethyl)-4-ethoxyphenyl]-N-[(4-ethylphenyl)methyl]imidazo[4,5-b]pyridin-6-amine |
| SMILES | CCOc1ccc(-n2cnc3cc(NCc4ccc(CC)cc4)cnc32)cc1CN |
| InChI | InChI=1S/C24H27N5O/c1-3-17-5-7-18(8-6-17)14-26-20-12-22-24(27-15-20)29(16-28-22)21-9-10-23(30-4-2)19(11-21)13-25/h5-12,15-16,26H,3-4,13-14,25H2,1-2H3 |
| InChIKey | GPTCBVWYDMSRMY-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[3-(aminomethyl)-4-ethoxyphenyl]-N-[(4-ethylphenyl)methyl]imidazo[4,5-b]pyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(aminomethyl)-4-ethoxyphenyl]-N-[(4-ethylphenyl)methyl]imidazo[4,5-b]pyridin-6-amine?
The IUPAC name of 3-[3-(aminomethyl)-4-ethoxyphenyl]-N-[(4-ethylphenyl)methyl]imidazo[4,5-b]pyridin-6-amine (CID 71521187) is 3-[3-(aminomethyl)-4-ethoxyphenyl]-N-[(4-ethylphenyl)methyl]imidazo[4,5-b]pyridin-6-amine.
What is the SMILES notation for 3-[3-(aminomethyl)-4-ethoxyphenyl]-N-[(4-ethylphenyl)methyl]imidazo[4,5-b]pyridin-6-amine?
The canonical SMILES for 3-[3-(aminomethyl)-4-ethoxyphenyl]-N-[(4-ethylphenyl)methyl]imidazo[4,5-b]pyridin-6-amine is CCOc1ccc(-n2cnc3cc(NCc4ccc(CC)cc4)cnc32)cc1CN.
What is the InChIKey of 3-[3-(aminomethyl)-4-ethoxyphenyl]-N-[(4-ethylphenyl)methyl]imidazo[4,5-b]pyridin-6-amine?
The InChIKey is GPTCBVWYDMSRMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H27N5O/c1-3-17-5-7-18(8-6-17)14-26-20-12-22-24(27-15-20)29(16-28-22)21-9-10-23(30-4-2)19(11-21)13-25/h5-12,15-16,26H,3-4,13-14,25H2,1-2H3.
What are the key properties of 3-[3-(aminomethyl)-4-ethoxyphenyl]-N-[(4-ethylphenyl)methyl]imidazo[4,5-b]pyridin-6-amine?
3-[3-(aminomethyl)-4-ethoxyphenyl]-N-[(4-ethylphenyl)methyl]imidazo[4,5-b]pyridin-6-amine has a molecular weight of 401.51 g/mol, XLogP of 4.45, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(aminomethyl)-4-ethoxyphenyl]-N-[(4-ethylphenyl)methyl]imidazo[4,5-b]pyridin-6-amine is sourced from PubChem (CID 71521187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).