C14H13N3Y+ — CID 20720945
carbanide;6-methyl-3-phenylimidazo[4,5-b]pyridine;yttrium(3+) (PubChem CID 20720945) has the molecular formula C14H13N3Y+ and a molecular weight of 312.19 g/mol. Its IUPAC name is carbanide;6-methyl-3-phenylimidazo[4,5-b]pyridine;yttrium(3+).
| Compound Name | carbanide;6-methyl-3-phenylimidazo[4,5-b]pyridine;yttrium(3+) |
|---|---|
| PubChem CID | 20720945 |
| Molecular Formula | C14H13N3Y+ |
| Molecular Weight | 312.19 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | carbanide;6-methyl-3-phenylimidazo[4,5-b]pyridine;yttrium(3+) |
| SMILES | Cc1cnc2c(c1)ncn2-c1c[c-]ccc1.[CH3-].[Y+3] |
| InChI | InChI=1S/C13H10N3.CH3.Y/c1-10-7-12-13(14-8-10)16(9-15-12)11-5-3-2-4-6-11;;/h2-3,5-9H,1H3;1H3;/q2*-1;+3 |
| InChIKey | KJMRSIBVEASYSM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.19 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|