C14H13N3Y-2 — CID 58883381
carbanide;7-methyl-3-phenylimidazo[1,2-b]pyridazine;yttrium (PubChem CID 58883381) has the molecular formula C14H13N3Y-2 and a molecular weight of 312.19 g/mol. Its IUPAC name is carbanide;7-methyl-3-phenylimidazo[1,2-b]pyridazine;yttrium.
| Compound Name | carbanide;7-methyl-3-phenylimidazo[1,2-b]pyridazine;yttrium |
|---|---|
| PubChem CID | 58883381 |
| Molecular Formula | C14H13N3Y-2 |
| Molecular Weight | 312.19 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | carbanide;7-methyl-3-phenylimidazo[1,2-b]pyridazine;yttrium |
| SMILES | Cc1cnn2c(-c3c[c-]ccc3)cnc2c1.[CH3-].[Y] |
| InChI | InChI=1S/C13H10N3.CH3.Y/c1-10-7-13-14-9-12(16(13)15-8-10)11-5-3-2-4-6-11;;/h2-3,5-9H,1H3;1H3;/q2*-1; |
| InChIKey | SMEGLNFCOJACPC-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.19 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|