C17H15N3 — CID 168942855
3-[2-(2,5-dimethylphenyl)ethynyl]-7-methylimidazo[1,2-b]pyridazine (PubChem CID 168942855) has the molecular formula C17H15N3 and a molecular weight of 261.33 g/mol. Its IUPAC name is 3-[2-(2,5-dimethylphenyl)ethynyl]-7-methylimidazo[1,2-b]pyridazine.
| Compound Name | 3-[2-(2,5-dimethylphenyl)ethynyl]-7-methylimidazo[1,2-b]pyridazine |
|---|---|
| PubChem CID | 168942855 |
| Molecular Formula | C17H15N3 |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 3-[2-(2,5-dimethylphenyl)ethynyl]-7-methylimidazo[1,2-b]pyridazine |
| SMILES | Cc1ccc(C)c(C#Cc2cnc3cc(C)cnn23)c1 |
| InChI | InChI=1S/C17H15N3/c1-12-4-5-14(3)15(8-12)6-7-16-11-18-17-9-13(2)10-19-20(16)17/h4-5,8-11H,1-3H3 |
| InChIKey | UUUWUZAKWNIMOI-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|