C26H21N5O — CID 172643517
3-[2-[7-(cyclopenten-1-yl)imidazo[1,2-b]pyridazin-3-yl]ethynyl]-4-methyl-N-pyridin-2-ylbenzamide (PubChem CID 172643517) has the molecular formula C26H21N5O and a molecular weight of 419.49 g/mol. Its IUPAC name is 3-[2-[7-(cyclopenten-1-yl)imidazo[1,2-b]pyridazin-3-yl]ethynyl]-4-methyl-N-pyridin-2-ylbenzamide.
| Compound Name | 3-[2-[7-(cyclopenten-1-yl)imidazo[1,2-b]pyridazin-3-yl]ethynyl]-4-methyl-N-pyridin-2-ylbenzamide |
|---|---|
| PubChem CID | 172643517 |
| Molecular Formula | C26H21N5O |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | 3-[2-[7-(cyclopenten-1-yl)imidazo[1,2-b]pyridazin-3-yl]ethynyl]-4-methyl-N-pyridin-2-ylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccccn2)cc1C#Cc1cnc2cc(C3=CCCC3)cnn12 |
| InChI | InChI=1S/C26H21N5O/c1-18-9-10-21(26(32)30-24-8-4-5-13-27-24)14-20(18)11-12-23-17-28-25-15-22(16-29-31(23)25)19-6-2-3-7-19/h4-6,8-10,13-17H,2-3,7H2,1H3,(H,27,30,32) |
| InChIKey | ILBGHRNRINAYIM-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|