C29H24F6N6O — CID 118494438
3-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-4-methyl-N-[3-(trifluoromethyl)-4-[[4-(trifluoromethyl)piperazin-1-yl]methyl]phenyl]benzamide (PubChem CID 118494438) has the molecular formula C29H24F6N6O and a molecular weight of 586.54 g/mol. Its IUPAC name is 3-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-4-methyl-N-[3-(trifluoromethyl)-4-[[4-(trifluoromethyl)piperazin-1-yl]methyl]phenyl]benzamide.
| Compound Name | 3-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-4-methyl-N-[3-(trifluoromethyl)-4-[[4-(trifluoromethyl)piperazin-1-yl]methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 118494438 |
| Molecular Formula | C29H24F6N6O |
| Molecular Weight | 586.54 g/mol |
| Exact Mass | 586.19 |
| IUPAC Name | 3-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-4-methyl-N-[3-(trifluoromethyl)-4-[[4-(trifluoromethyl)piperazin-1-yl]methyl]phenyl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(CN3CCN(C(F)(F)F)CC3)c(C(F)(F)F)c2)cc1C#Cc1cnc2cccnn12 |
| InChI | InChI=1S/C29H24F6N6O/c1-19-4-5-21(15-20(19)7-9-24-17-36-26-3-2-10-37-41(24)26)27(42)38-23-8-6-22(25(16-23)28(30,31)32)18-39-11-13-40(14-12-39)29(33,34)35/h2-6,8,10,15-17H,11-14,18H2,1H3,(H,38,42) |
| InChIKey | VLJGXMJUKXCGIO-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 65.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.54 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|