C34H32F3N9O — CID 154693393
3-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-4-methyl-N-[4-[[2-(4-pyrimidin-4-ylpiperazin-1-yl)ethylamino]methyl]-3-(trifluoromethyl)phenyl]benzamide (PubChem CID 154693393) has the molecular formula C34H32F3N9O and a molecular weight of 639.69 g/mol. Its IUPAC name is 3-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-4-methyl-N-[4-[[2-(4-pyrimidin-4-ylpiperazin-1-yl)ethylamino]methyl]-3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-4-methyl-N-[4-[[2-(4-pyrimidin-4-ylpiperazin-1-yl)ethylamino]methyl]-3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 154693393 |
| Molecular Formula | C34H32F3N9O |
| Molecular Weight | 639.69 g/mol |
| Exact Mass | 639.27 |
| IUPAC Name | 3-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-4-methyl-N-[4-[[2-(4-pyrimidin-4-ylpiperazin-1-yl)ethylamino]methyl]-3-(trifluoromethyl)phenyl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(CNCCN3CCN(c4ccncn4)CC3)c(C(F)(F)F)c2)cc1C#Cc1cnc2cccnn12 |
| InChI | InChI=1S/C34H32F3N9O/c1-24-4-5-26(19-25(24)7-9-29-22-40-32-3-2-11-42-46(29)32)33(47)43-28-8-6-27(30(20-28)34(35,36)37)21-38-13-14-44-15-17-45(18-16-44)31-10-12-39-23-41-31/h2-6,8,10-12,19-20,22-23,38H,13-18,21H2,1H3,(H,43,47) |
| InChIKey | GGDMBZNZEMBILU-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 103.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.69 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|