C31H32F3N7OS — CID 154693364
3-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-4-methyl-N-[4-[[2-(4-methylsulfanylpiperazin-1-yl)ethylamino]methyl]-3-(trifluoromethyl)phenyl]benzamide (PubChem CID 154693364) has the molecular formula C31H32F3N7OS and a molecular weight of 607.71 g/mol. Its IUPAC name is 3-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-4-methyl-N-[4-[[2-(4-methylsulfanylpiperazin-1-yl)ethylamino]methyl]-3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-4-methyl-N-[4-[[2-(4-methylsulfanylpiperazin-1-yl)ethylamino]methyl]-3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 154693364 |
| Molecular Formula | C31H32F3N7OS |
| Molecular Weight | 607.71 g/mol |
| Exact Mass | 607.23 |
| IUPAC Name | 3-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-4-methyl-N-[4-[[2-(4-methylsulfanylpiperazin-1-yl)ethylamino]methyl]-3-(trifluoromethyl)phenyl]benzamide |
| SMILES | CSN1CCN(CCNCc2ccc(NC(=O)c3ccc(C)c(C#Cc4cnc5cccnn45)c3)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C31H32F3N7OS/c1-22-5-6-24(18-23(22)8-10-27-21-36-29-4-3-11-37-41(27)29)30(42)38-26-9-7-25(28(19-26)31(32,33)34)20-35-12-13-39-14-16-40(43-2)17-15-39/h3-7,9,11,18-19,21,35H,12-17,20H2,1-2H3,(H,38,42) |
| InChIKey | RLUYPBVJJKLKNJ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 77.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.71 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|