C25H19F3N6O — CID 24826821
N-[4-(2-amino-2-iminoethyl)-3-(trifluoromethyl)phenyl]-3-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-4-methylbenzamide (PubChem CID 24826821) has the molecular formula C25H19F3N6O and a molecular weight of 476.46 g/mol. Its IUPAC name is N-[4-(2-amino-2-iminoethyl)-3-(trifluoromethyl)phenyl]-3-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-4-methylbenzamide.
| Compound Name | N-[4-(2-amino-2-iminoethyl)-3-(trifluoromethyl)phenyl]-3-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-4-methylbenzamide |
|---|---|
| PubChem CID | 24826821 |
| Molecular Formula | C25H19F3N6O |
| Molecular Weight | 476.46 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | N-[4-(2-amino-2-iminoethyl)-3-(trifluoromethyl)phenyl]-3-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-4-methylbenzamide |
| SMILES | [H]/N=C(\N)Cc1ccc(NC(=O)c2ccc(C)c(C#Cc3cnc4cccnn34)c2)cc1C(F)(F)F |
| InChI | InChI=1S/C25H19F3N6O/c1-15-4-5-18(11-16(15)7-9-20-14-31-23-3-2-10-32-34(20)23)24(35)33-19-8-6-17(12-22(29)30)21(13-19)25(26,27)28/h2-6,8,10-11,13-14H,12H2,1H3,(H3,29,30)(H,33,35) |
| InChIKey | LYWDWHXCXJXXKK-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 109.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.46 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|