C39H46F3N7O3 — CID 163276209
tert-butyl N-[6-[4-[[4-[[3-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-4-methylbenzoyl]amino]-2-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]hexyl]carbamate (PubChem CID 163276209) has the molecular formula C39H46F3N7O3 and a molecular weight of 717.84 g/mol. Its IUPAC name is tert-butyl N-[6-[4-[[4-[[3-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-4-methylbenzoyl]amino]-2-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]hexyl]carbamate.
| Compound Name | tert-butyl N-[6-[4-[[4-[[3-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-4-methylbenzoyl]amino]-2-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]hexyl]carbamate |
|---|---|
| PubChem CID | 163276209 |
| Molecular Formula | C39H46F3N7O3 |
| Molecular Weight | 717.84 g/mol |
| Exact Mass | 717.36 |
| IUPAC Name | tert-butyl N-[6-[4-[[4-[[3-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-4-methylbenzoyl]amino]-2-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]hexyl]carbamate |
| SMILES | Cc1ccc(C(=O)Nc2ccc(CN3CCN(CCCCCCNC(=O)OC(C)(C)C)CC3)c(C(F)(F)F)c2)cc1C#Cc1cnc2cccnn12 |
| InChI | InChI=1S/C39H46F3N7O3/c1-28-11-12-30(24-29(28)14-16-33-26-44-35-10-9-18-45-49(33)35)36(50)46-32-15-13-31(34(25-32)39(40,41)42)27-48-22-20-47(21-23-48)19-8-6-5-7-17-43-37(51)52-38(2,3)4/h9-13,15,18,24-26H,5-8,17,19-23,27H2,1-4H3,(H,43,51)(H,46,50) |
| InChIKey | ABADCTGASGWNAU-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 104.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.84 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|