C31H30F3N5O3 — CID 168952967
N-[4-[8-(hydroxyamino)-8-oxooctyl]-3-(trifluoromethyl)phenyl]-3-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-4-methylbenzamide (PubChem CID 168952967) has the molecular formula C31H30F3N5O3 and a molecular weight of 577.61 g/mol. Its IUPAC name is N-[4-[8-(hydroxyamino)-8-oxooctyl]-3-(trifluoromethyl)phenyl]-3-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-4-methylbenzamide.
| Compound Name | N-[4-[8-(hydroxyamino)-8-oxooctyl]-3-(trifluoromethyl)phenyl]-3-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-4-methylbenzamide |
|---|---|
| PubChem CID | 168952967 |
| Molecular Formula | C31H30F3N5O3 |
| Molecular Weight | 577.61 g/mol |
| Exact Mass | 577.23 |
| IUPAC Name | N-[4-[8-(hydroxyamino)-8-oxooctyl]-3-(trifluoromethyl)phenyl]-3-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(CCCCCCCC(=O)NO)c(C(F)(F)F)c2)cc1C#Cc1cnc2cccnn12 |
| InChI | InChI=1S/C31H30F3N5O3/c1-21-11-12-24(18-23(21)14-16-26-20-35-28-9-7-17-36-39(26)28)30(41)37-25-15-13-22(27(19-25)31(32,33)34)8-5-3-2-4-6-10-29(40)38-42/h7,9,11-13,15,17-20,42H,2-6,8,10H2,1H3,(H,37,41)(H,38,40) |
| InChIKey | CSCLFQBLBFGFNV-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 108.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.61 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|