C13H12N4Y+ — CID 23600256
carbanide;3-methyl-7-phenylimidazo[1,2-b][1,2,4]triazine;yttrium(3+) (PubChem CID 23600256) has the molecular formula C13H12N4Y+ and a molecular weight of 313.17 g/mol. Its IUPAC name is carbanide;3-methyl-7-phenylimidazo[1,2-b][1,2,4]triazine;yttrium(3+).
| Compound Name | carbanide;3-methyl-7-phenylimidazo[1,2-b][1,2,4]triazine;yttrium(3+) |
|---|---|
| PubChem CID | 23600256 |
| Molecular Formula | C13H12N4Y+ |
| Molecular Weight | 313.17 g/mol |
| Exact Mass | 313.01 |
| IUPAC Name | carbanide;3-methyl-7-phenylimidazo[1,2-b][1,2,4]triazine;yttrium(3+) |
| SMILES | Cc1cnn2c(-c3c[c-]ccc3)cnc2n1.[CH3-].[Y+3] |
| InChI | InChI=1S/C12H9N4.CH3.Y/c1-9-7-14-16-11(8-13-12(16)15-9)10-5-3-2-4-6-10;;/h2-3,5-8H,1H3;1H3;/q2*-1;+3 |
| InChIKey | BLJQRKZKSJXNDJ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.17 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|