C18H13IN4 — CID 143706847
3-[6-(4-iodophenyl)imidazo[4,5-b]pyridin-3-yl]aniline (PubChem CID 143706847) has the molecular formula C18H13IN4 and a molecular weight of 412.23 g/mol. Its IUPAC name is 3-[6-(4-iodophenyl)imidazo[4,5-b]pyridin-3-yl]aniline.
| Compound Name | 3-[6-(4-iodophenyl)imidazo[4,5-b]pyridin-3-yl]aniline |
|---|---|
| PubChem CID | 143706847 |
| Molecular Formula | C18H13IN4 |
| Molecular Weight | 412.23 g/mol |
| Exact Mass | 412.02 |
| IUPAC Name | 3-[6-(4-iodophenyl)imidazo[4,5-b]pyridin-3-yl]aniline |
| SMILES | Nc1cccc(-n2cnc3cc(-c4ccc(I)cc4)cnc32)c1 |
| InChI | InChI=1S/C18H13IN4/c19-14-6-4-12(5-7-14)13-8-17-18(21-10-13)23(11-22-17)16-3-1-2-15(20)9-16/h1-11H,20H2 |
| InChIKey | YRECAUCDDJAPBW-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.23 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|