C20H16N2O2 — CID 141304927
1-methyl-6,7-diphenylpyrido[2,3-b][1,4]oxazin-2-one (PubChem CID 141304927) has the molecular formula C20H16N2O2 and a molecular weight of 316.36 g/mol. Its IUPAC name is 1-methyl-6,7-diphenylpyrido[2,3-b][1,4]oxazin-2-one.
| Compound Name | 1-methyl-6,7-diphenylpyrido[2,3-b][1,4]oxazin-2-one |
|---|---|
| PubChem CID | 141304927 |
| Molecular Formula | C20H16N2O2 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 1-methyl-6,7-diphenylpyrido[2,3-b][1,4]oxazin-2-one |
| SMILES | CN1C(=O)COc2nc(-c3ccccc3)c(-c3ccccc3)cc21 |
| InChI | InChI=1S/C20H16N2O2/c1-22-17-12-16(14-8-4-2-5-9-14)19(15-10-6-3-7-11-15)21-20(17)24-13-18(22)23/h2-12H,13H2,1H3 |
| InChIKey | TXGCQFHOFYYBNN-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |