C15H10BrF3N2O2 — CID 86683678
6-bromo-7-phenyl-1-(2,2,2-trifluoroethyl)pyrido[2,3-b][1,4]oxazin-2-one (PubChem CID 86683678) has the molecular formula C15H10BrF3N2O2 and a molecular weight of 387.16 g/mol. Its IUPAC name is 6-bromo-7-phenyl-1-(2,2,2-trifluoroethyl)pyrido[2,3-b][1,4]oxazin-2-one.
| Compound Name | 6-bromo-7-phenyl-1-(2,2,2-trifluoroethyl)pyrido[2,3-b][1,4]oxazin-2-one |
|---|---|
| PubChem CID | 86683678 |
| Molecular Formula | C15H10BrF3N2O2 |
| Molecular Weight | 387.16 g/mol |
| Exact Mass | 385.99 |
| IUPAC Name | 6-bromo-7-phenyl-1-(2,2,2-trifluoroethyl)pyrido[2,3-b][1,4]oxazin-2-one |
| SMILES | O=C1COc2nc(Br)c(-c3ccccc3)cc2N1CC(F)(F)F |
| InChI | InChI=1S/C15H10BrF3N2O2/c16-13-10(9-4-2-1-3-5-9)6-11-14(20-13)23-7-12(22)21(11)8-15(17,18)19/h1-6H,7-8H2 |
| InChIKey | MMKIHGUZXDDZOT-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.16 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|