About magnesium;2-ethyladamantan-2-olate;chloride
magnesium;2-ethyladamantan-2-olate;chloride (PubChem CID 141311408) has the molecular formula C12H19ClMgO
and a molecular weight of 239.04 g/mol. Its IUPAC name is magnesium;2-ethyladamantan-2-olate;chloride.
Molecular Properties
| Compound Name | magnesium;2-ethyladamantan-2-olate;chloride |
| PubChem CID | 141311408 |
| Molecular Formula | C12H19ClMgO |
| Molecular Weight | 239.04 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | magnesium;2-ethyladamantan-2-olate;chloride |
| SMILES | CCC1([O-])C2CC3CC(C2)CC1C3.[Cl-].[Mg+2] |
| InChI | InChI=1S/C12H19O.ClH.Mg/c1-2-12(13)10-4-8-3-9(6-10)7-11(12)5-8;;/h8-11H,2-7H2,1H3;1H;/q-1;;+2/p-1 |
| InChIKey | RXFJQFOTVXZSEL-UHFFFAOYSA-M |
| XLogP | -1.43 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.04 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze magnesium;2-ethyladamantan-2-olate;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;2-ethyladamantan-2-olate;chloride?
The IUPAC name of magnesium;2-ethyladamantan-2-olate;chloride (CID 141311408) is magnesium;2-ethyladamantan-2-olate;chloride.
What is the SMILES notation for magnesium;2-ethyladamantan-2-olate;chloride?
The canonical SMILES for magnesium;2-ethyladamantan-2-olate;chloride is CCC1([O-])C2CC3CC(C2)CC1C3.[Cl-].[Mg+2].
What is the InChIKey of magnesium;2-ethyladamantan-2-olate;chloride?
The InChIKey is RXFJQFOTVXZSEL-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H19O.ClH.Mg/c1-2-12(13)10-4-8-3-9(6-10)7-11(12)5-8;;/h8-11H,2-7H2,1H3;1H;/q-1;;+2/p-1.
What are the key properties of magnesium;2-ethyladamantan-2-olate;chloride?
magnesium;2-ethyladamantan-2-olate;chloride has a molecular weight of 239.04 g/mol, XLogP of -1.43, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;2-ethyladamantan-2-olate;chloride is sourced from PubChem (CID 141311408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).