About 2,2-di(ethyl)adamantane;yttrium
2,2-di(ethyl)adamantane;yttrium (PubChem CID 162698514) has the molecular formula C14H22Y-2
and a molecular weight of 279.24 g/mol. Its IUPAC name is 2,2-di(ethyl)adamantane;yttrium.
Molecular Properties
| Compound Name | 2,2-di(ethyl)adamantane;yttrium |
| PubChem CID | 162698514 |
| Molecular Formula | C14H22Y-2 |
| Molecular Weight | 279.24 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 2,2-di(ethyl)adamantane;yttrium |
| SMILES | [CH2-]CC1(C[CH2-])C2CC3CC(C2)CC1C3.[Y] |
| InChI | InChI=1S/C14H22.Y/c1-3-14(4-2)12-6-10-5-11(8-12)9-13(14)7-10;/h10-13H,1-9H2;/q-2; |
| InChIKey | CDOPWSIKUCRDKN-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.24 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2,2-di(ethyl)adamantane;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-di(ethyl)adamantane;yttrium?
The IUPAC name of 2,2-di(ethyl)adamantane;yttrium (CID 162698514) is 2,2-di(ethyl)adamantane;yttrium.
What is the SMILES notation for 2,2-di(ethyl)adamantane;yttrium?
The canonical SMILES for 2,2-di(ethyl)adamantane;yttrium is [CH2-]CC1(C[CH2-])C2CC3CC(C2)CC1C3.[Y].
What is the InChIKey of 2,2-di(ethyl)adamantane;yttrium?
The InChIKey is CDOPWSIKUCRDKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22.Y/c1-3-14(4-2)12-6-10-5-11(8-12)9-13(14)7-10;/h10-13H,1-9H2;/q-2;.
What are the key properties of 2,2-di(ethyl)adamantane;yttrium?
2,2-di(ethyl)adamantane;yttrium has a molecular weight of 279.24 g/mol, XLogP of 3.87, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-di(ethyl)adamantane;yttrium is sourced from PubChem (CID 162698514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).