C13H19N5O3S — CID 141313276
9-(1-propylsulfonylpiperidin-3-yl)-7H-purin-8-one (PubChem CID 141313276) has the molecular formula C13H19N5O3S and a molecular weight of 325.39 g/mol. Its IUPAC name is 9-(1-propylsulfonylpiperidin-3-yl)-7H-purin-8-one.
| Compound Name | 9-(1-propylsulfonylpiperidin-3-yl)-7H-purin-8-one |
|---|---|
| PubChem CID | 141313276 |
| Molecular Formula | C13H19N5O3S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 9-(1-propylsulfonylpiperidin-3-yl)-7H-purin-8-one |
| SMILES | CCCS(=O)(=O)N1CCCC(n2c(=O)[nH]c3cncnc32)C1 |
| InChI | InChI=1S/C13H19N5O3S/c1-2-6-22(20,21)17-5-3-4-10(8-17)18-12-11(16-13(18)19)7-14-9-15-12/h7,9-10H,2-6,8H2,1H3,(H,16,19) |
| InChIKey | IRKTVYFNHUEFJD-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 100.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |