C18H27N7O3S — CID 171343229
8-cyclopentyl-6-(methylamino)-2-[(1-methylsulfonylpiperidin-4-yl)amino]pteridin-7-one (PubChem CID 171343229) has the molecular formula C18H27N7O3S and a molecular weight of 421.53 g/mol. Its IUPAC name is 8-cyclopentyl-6-(methylamino)-2-[(1-methylsulfonylpiperidin-4-yl)amino]pteridin-7-one.
| Compound Name | 8-cyclopentyl-6-(methylamino)-2-[(1-methylsulfonylpiperidin-4-yl)amino]pteridin-7-one |
|---|---|
| PubChem CID | 171343229 |
| Molecular Formula | C18H27N7O3S |
| Molecular Weight | 421.53 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 8-cyclopentyl-6-(methylamino)-2-[(1-methylsulfonylpiperidin-4-yl)amino]pteridin-7-one |
| SMILES | CNc1nc2cnc(NC3CCN(S(C)(=O)=O)CC3)nc2n(C2CCCC2)c1=O |
| InChI | InChI=1S/C18H27N7O3S/c1-19-15-17(26)25(13-5-3-4-6-13)16-14(22-15)11-20-18(23-16)21-12-7-9-24(10-8-12)29(2,27)28/h11-13H,3-10H2,1-2H3,(H,19,22)(H,20,21,23) |
| InChIKey | CTLPBXGKVQYAJL-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 122.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.53 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |