C17H26N6O4S — CID 171344335
2-[(1-methylsulfonylpiperidin-4-yl)amino]-8-pentan-3-yl-5H-pteridine-6,7-dione (PubChem CID 171344335) has the molecular formula C17H26N6O4S and a molecular weight of 410.50 g/mol. Its IUPAC name is 2-[(1-methylsulfonylpiperidin-4-yl)amino]-8-pentan-3-yl-5H-pteridine-6,7-dione.
| Compound Name | 2-[(1-methylsulfonylpiperidin-4-yl)amino]-8-pentan-3-yl-5H-pteridine-6,7-dione |
|---|---|
| PubChem CID | 171344335 |
| Molecular Formula | C17H26N6O4S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 2-[(1-methylsulfonylpiperidin-4-yl)amino]-8-pentan-3-yl-5H-pteridine-6,7-dione |
| SMILES | CCC(CC)n1c(=O)c(=O)[nH]c2cnc(NC3CCN(S(C)(=O)=O)CC3)nc21 |
| InChI | InChI=1S/C17H26N6O4S/c1-4-12(5-2)23-14-13(20-15(24)16(23)25)10-18-17(21-14)19-11-6-8-22(9-7-11)28(3,26)27/h10-12H,4-9H2,1-3H3,(H,20,24)(H,18,19,21) |
| InChIKey | DCQUJDIXVDRXDK-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 130.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|