C17H24N6O5S — CID 171348208
8-[(1R,2R)-2-hydroxycyclopentyl]-2-[(1-methylsulfonylpiperidin-4-yl)amino]-5H-pteridine-6,7-dione (PubChem CID 171348208) has the molecular formula C17H24N6O5S and a molecular weight of 424.48 g/mol. Its IUPAC name is 8-[(1R,2R)-2-hydroxycyclopentyl]-2-[(1-methylsulfonylpiperidin-4-yl)amino]-5H-pteridine-6,7-dione.
| Compound Name | 8-[(1R,2R)-2-hydroxycyclopentyl]-2-[(1-methylsulfonylpiperidin-4-yl)amino]-5H-pteridine-6,7-dione |
|---|---|
| PubChem CID | 171348208 |
| Molecular Formula | C17H24N6O5S |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 8-[(1R,2R)-2-hydroxycyclopentyl]-2-[(1-methylsulfonylpiperidin-4-yl)amino]-5H-pteridine-6,7-dione |
| SMILES | CS(=O)(=O)N1CCC(Nc2ncc3[nH]c(=O)c(=O)n([C@@H]4CCC[C@H]4O)c3n2)CC1 |
| InChI | InChI=1S/C17H24N6O5S/c1-29(27,28)22-7-5-10(6-8-22)19-17-18-9-11-14(21-17)23(16(26)15(25)20-11)12-3-2-4-13(12)24/h9-10,12-13,24H,2-8H2,1H3,(H,20,25)(H,18,19,21)/t12-,13-/m1/s1 |
| InChIKey | AYIAADJCNZOSHJ-CHWSQXEVSA-N |
| XLogP | -0.60 |
| TPSA | 150.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|