C18H27N7O4S — CID 171349598
4-[(8-cyclopentyl-6,7-dioxo-5H-pteridin-2-yl)amino]-N,N-dimethylpiperidine-1-sulfonamide (PubChem CID 171349598) has the molecular formula C18H27N7O4S and a molecular weight of 437.53 g/mol. Its IUPAC name is 4-[(8-cyclopentyl-6,7-dioxo-5H-pteridin-2-yl)amino]-N,N-dimethylpiperidine-1-sulfonamide.
| Compound Name | 4-[(8-cyclopentyl-6,7-dioxo-5H-pteridin-2-yl)amino]-N,N-dimethylpiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 171349598 |
| Molecular Formula | C18H27N7O4S |
| Molecular Weight | 437.53 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | 4-[(8-cyclopentyl-6,7-dioxo-5H-pteridin-2-yl)amino]-N,N-dimethylpiperidine-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CCC(Nc2ncc3[nH]c(=O)c(=O)n(C4CCCC4)c3n2)CC1 |
| InChI | InChI=1S/C18H27N7O4S/c1-23(2)30(28,29)24-9-7-12(8-10-24)20-18-19-11-14-15(22-18)25(13-5-3-4-6-13)17(27)16(26)21-14/h11-13H,3-10H2,1-2H3,(H,21,26)(H,19,20,22) |
| InChIKey | WSMDISWZRPKJEC-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 133.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.53 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|