C16H24N6O4S — CID 171349420
8-butan-2-yl-2-[(1-methylsulfonylpiperidin-4-yl)amino]-5H-pteridine-6,7-dione (PubChem CID 171349420) has the molecular formula C16H24N6O4S and a molecular weight of 396.47 g/mol. Its IUPAC name is 8-butan-2-yl-2-[(1-methylsulfonylpiperidin-4-yl)amino]-5H-pteridine-6,7-dione.
| Compound Name | 8-butan-2-yl-2-[(1-methylsulfonylpiperidin-4-yl)amino]-5H-pteridine-6,7-dione |
|---|---|
| PubChem CID | 171349420 |
| Molecular Formula | C16H24N6O4S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 8-butan-2-yl-2-[(1-methylsulfonylpiperidin-4-yl)amino]-5H-pteridine-6,7-dione |
| SMILES | CCC(C)n1c(=O)c(=O)[nH]c2cnc(NC3CCN(S(C)(=O)=O)CC3)nc21 |
| InChI | InChI=1S/C16H24N6O4S/c1-4-10(2)22-13-12(19-14(23)15(22)24)9-17-16(20-13)18-11-5-7-21(8-6-11)27(3,25)26/h9-11H,4-8H2,1-3H3,(H,19,23)(H,17,18,20) |
| InChIKey | DKGFLEPCCGIZQP-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 130.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|