C16H23N7O4S — CID 171354577
2-[(1-methylsulfonylpiperidin-4-yl)amino]-8-pyrrolidin-3-yl-5H-pteridine-6,7-dione (PubChem CID 171354577) has the molecular formula C16H23N7O4S and a molecular weight of 409.47 g/mol. Its IUPAC name is 2-[(1-methylsulfonylpiperidin-4-yl)amino]-8-pyrrolidin-3-yl-5H-pteridine-6,7-dione.
| Compound Name | 2-[(1-methylsulfonylpiperidin-4-yl)amino]-8-pyrrolidin-3-yl-5H-pteridine-6,7-dione |
|---|---|
| PubChem CID | 171354577 |
| Molecular Formula | C16H23N7O4S |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | 2-[(1-methylsulfonylpiperidin-4-yl)amino]-8-pyrrolidin-3-yl-5H-pteridine-6,7-dione |
| SMILES | CS(=O)(=O)N1CCC(Nc2ncc3[nH]c(=O)c(=O)n(C4CCNC4)c3n2)CC1 |
| InChI | InChI=1S/C16H23N7O4S/c1-28(26,27)22-6-3-10(4-7-22)19-16-18-9-12-13(21-16)23(11-2-5-17-8-11)15(25)14(24)20-12/h9-11,17H,2-8H2,1H3,(H,20,24)(H,18,19,21) |
| InChIKey | QEUJAPLBDWRCOC-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 142.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|